Interesting facts
Interesting Facts About 7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8-triene-10,11-dione
This fascinating compound, known as 7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8-triene-10,11-dione, showcases a complex structure that epitomizes the intricate nature of organic chemistry. Here are some noteworthy points:
- Chemical Framework: The structure features a unique bicyclic system with multiple reactive sites, making it a potential candidate for various chemical reactions.
- Active Research Area: Due to its diazatricyclo framework, its derivatives have emerged as subjects of interest in medicinal chemistry, particularly for their potential biological activities.
- Functional Groups: The presence of both dione and methyl groups can influence the electronic properties, thus affecting reactivity and stability in different environments.
- Potential Applications: Compounds like this one may serve as precursors for synthesizing complex organic molecules, beneficial in pharmaceuticals, agrochemicals, and material science.
- Mechanistic Studies: Understanding the reaction pathways involving this compound can provide insights into the stability and behavior of diazatricyclic frameworks in chemical synthesis.
This compound exemplifies how intricate structures can lead to exciting opportunities in discovery and innovation within the field of chemistry. As research continues, the full scope of its applications and properties is likely to emerge, highlighting the importance of studying complex molecular architectures.
Synonyms
Damirone B
138683-67-7
7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8-triene-10,11-dione
5-Methyl-4,5-dihydropyrrolo[4,3,2-de]quinoline-7,8(1H,3H)-dione
Pyrrolo[4,3,2-de]quinoline-7,8-dione, 1,3,4,5-tetrahydro-5-methyl- (9CI)
CHEMBL462951
SCHEMBL9263961
JYLGJUYDUWMFOL-UHFFFAOYSA-
DTXSID40930190
5-methyl-1,3,4,5-tetrahydropyrrolo[4,3,2-de]quinoline-7,8-dione
NSC700004
NSC 700004
NSC-700004
Pyrrolo(4,3,2-de)quinoline-7,8-dione, 1,3,4,5-tetrahydro-5-methyl-
Pyrrolo[4,2-de]quinoline-7,8-dione, 1,3,4,5-tetrahydro-5-methyl-
InChI=1/C11H10N2O2/c1-13-3-2-6-5-12-10-9(6)7(13)4-8(14)11(10)15/h4-5,12H,2-3H2,1H3
Solubility of 7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8-triene-10,11-dione
The solubility of 7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8-triene-10,11-dione (C28H26N4O3) can be characterized as follows:
Quote: "When determining solubility, one must consider both the structure of the compound and the properties of the solvent." This emphasizes the significance of molecular interactions in predicting solubility behavior.
Overall, due to its unique structure, 7-methyl-2,7-diazatricyclo[6.3.1.04,12]dodeca-1(12),3,8-triene-10,11-dione is expected to behave differently in various solvent systems, and experimentation is necessary to accurately define its solubility profile.