Interesting facts
Interesting Facts about 3,4,5,6-tetrahydroxytetrahydropyran-2-carboxamide
3,4,5,6-tetrahydroxytetrahydropyran-2-carboxamide is a fascinating compound that showcases the intricate world of organic chemistry. Here are some captivating details about this compound:
- Structural Complexity: This molecule features a tetrahydropyran ring, which is an essential building block in many natural products and pharmacologically active compounds. Its structure includes multiple hydroxyl (–OH) groups, contributing to its reactivity and functionality.
- Potential Biological Relevance: Compounds with similar structures often exhibit significant biological activity. Research has suggested that such hydroxylated compounds can interact with biological systems in terms of enzyme inhibition or as potential drug leads.
- Chirality: The presence of multiple chiral centers in this compound allows for various stereoisomers, which can lead to different properties and activities. Studying these stereochemical variations can be crucial in drug development.
- Synthesis Challenges: Synthesizing this compound may involve intricate synthetic routes, requiring careful consideration of reaction conditions to achieve the desired selectivity and yield.
As a compound rich in hydroxy groups and a distinct cyclic structure, 3,4,5,6-tetrahydroxytetrahydropyran-2-carboxamide exemplifies the rich tapestry of organic chemistry. Its potential roles in medicinal chemistry and materials science make it a subject of ongoing research, underscoring the importance of understanding complex organic molecules in our pursuit of new therapeutic agents.
Synonyms
3,4,5,6-tetrahydroxyoxane-2-carboxamide
SCHEMBL1064235
VOIFKEWOFUNPBN-UHFFFAOYSA-
DTXSID50860772
2,3,4,5-tetrahydroxy-6-oxohexanamide
DB-049212
InChI=1/C6H11NO6/c7-5(11)4-2(9)1(8)3(10)6(12)13-4/h1-4,6,8-10,12H,(H2,7,11)
Solubility of 3,4,5,6-tetrahydroxytetrahydropyran-2-carboxamide (C6H13NO6)
3,4,5,6-tetrahydroxytetrahydropyran-2-carboxamide is a highly hydrophilic compound due to the presence of multiple hydroxyl (-OH) groups and an amide functional group. This unique structure contributes significantly to its solubility characteristics.
In solution, one could say that the compound embodies the essence of hydrophilicity as it can interact favorably with water molecules. As a result, one can frequently anticipate that it can easily dissolve in aqueous environments, which may be advantageous in various chemical and biological applications.
Overall, the solubility of 3,4,5,6-tetrahydroxytetrahydropyran-2-carboxamide underlines the relationship between chemical structure and its interaction with solvents, showcasing how functional groups dictate solubility behavior.